Difference between revisions of "CPD-11401"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...") |
(Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11401 == |
+ | * common-name: | ||
+ | ** l-thyroxine acyl β-d-glucuronide | ||
* smiles: | * smiles: | ||
− | ** c | + | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3))) |
− | * | + | * inchi-key: |
− | ** | + | ** hmtfxpjobpioin-dkbymcrtsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 951.992 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10608]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-thyroxine acyl β-d-glucuronide}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}} |
+ | {{#set: molecular-weight=951.992}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11401
- common-name:
- l-thyroxine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
- inchi-key:
- hmtfxpjobpioin-dkbymcrtsa-m
- molecular-weight:
- 951.992