Difference between revisions of "CPD-11401"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20267 == * transcription-direction: ** negative * right-end-position: ** 206909 * left-end-position: ** 202750 * centisome-position: ** 96.57706...") |
(Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11401 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-thyroxine acyl β-d-glucuronide |
| − | + | * smiles: | |
| − | + | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3))) | |
| − | * | + | * inchi-key: |
| − | ** | + | ** hmtfxpjobpioin-dkbymcrtsa-m |
| − | + | * molecular-weight: | |
| − | + | ** 951.992 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-10608]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=l-thyroxine acyl β-d-glucuronide}} | |
| − | ** | + | {{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}} |
| − | + | {{#set: molecular-weight=951.992}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | == | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11401
- common-name:
- l-thyroxine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
- inchi-key:
- hmtfxpjobpioin-dkbymcrtsa-m
- molecular-weight:
- 951.992
