Difference between revisions of "CPD-11402"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...")
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7002 ==
+
== Metabolite Dietary-retinyl-esters ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl diphosphate
+
** a dietary all-trans-retinyl ester
* smiles:
 
** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** yjganofpasczbk-wcnzlwbosa-k
 
* molecular-weight:
 
** 449.44
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7658]]
+
* [[RXN-12579]]
* [[RXN-7659]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7658]]
 
* [[RXN-7659]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=a dietary all-trans-retinyl ester}}
{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
 
{{#set: molecular-weight=449.44}}
 

Revision as of 11:14, 15 January 2021

Metabolite Dietary-retinyl-esters

  • common-name:
    • a dietary all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality