Difference between revisions of "CPD-11403"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRP-tRNAs == * common-name: ** a trnatrp == Reaction(s) known to consume the compound == * TRYPTOPHAN--TRNA-LIGASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11403 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate |
| + | * smiles: | ||
| + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) | ||
| + | * inchi-key: | ||
| + | ** ppjyssnksxavdb-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 746.825 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10616]] |
| + | * [[RXN-10617]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate}} |
| + | {{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=746.825}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11403
- common-name:
- tetraiodothyroacetate
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- ppjyssnksxavdb-uhfffaoysa-m
- molecular-weight:
- 746.825
