Difference between revisions of "CPD-11403"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8083 == * common-name: ** 1-18:2-2-18:3-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite TRP-tRNAs == * common-name: ** a trnatrp == Reaction(s) known to consume the compound == * TRYPTOPHAN--TRNA-LIGASE-RXN == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8083 ==
+
== Metabolite TRP-tRNAs ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:3-digalactosyldiacylglycerol
+
** a trnatrp
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
** gkshydzifvnlss-ipdwfasdsa-n
 
* molecular-weight:
 
** 939.231
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8314]]
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8313]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
+
{{#set: common-name=a trnatrp}}
{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
 
{{#set: molecular-weight=939.231}}
 

Revision as of 18:57, 14 January 2021

Metabolite TRP-tRNAs

  • common-name:
    • a trnatrp

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality