Difference between revisions of "CPD-11404"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] == * direction: ** left-to-right * common-name: ** purine nucleosidase * ec-numb...")
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] ==
+
== Metabolite CPD-11404 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** purine nucleosidase
+
** 3,3',5-triiodothyroacetate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.2.2.1 ec-3.2.2.1]
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[WATER]][c] '''+''' 1 [[XANTHOSINE]][c] '''=>''' 1 [[D-Ribofuranose]][c] '''+''' 1 [[XANTHINE]][c]
+
** uowzuvnaguaeqc-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02916]]
+
** 620.928
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-10618]]
−
* Gene: [[SJ14933]]
+
* [[RXN-10619]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=3,3',5-triiodothyroacetate}}
−
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
+
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=620.928}}
−
* [[PWY-6607]], guanosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27995 27995]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02143 R02143]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=purine nucleosidase}}
 
−
{{#set: ec-number=ec-3.2.2.1}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11404

  • common-name:
    • 3,3',5-triiodothyroacetate
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
  • inchi-key:
    • uowzuvnaguaeqc-uhfffaoysa-m
  • molecular-weight:
    • 620.928

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11404&oldid=139321"