Difference between revisions of "CPD-11407"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...") |
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11407 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thyroxine sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qyxijuzwssqict-lbprgkrzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 855.924 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10614]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thyroxine sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=855.924}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-11407
- common-name:
- thyroxine sulfate
- smiles:
- c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
- inchi-key:
- qyxijuzwssqict-lbprgkrzsa-m
- molecular-weight:
- 855.924
