Difference between revisions of "CPD-11407"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9104 RXN-9104] == * direction: ** left-to-right * common-name: ** 1,4-beta-d-xylan synthase * e...")
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9104 RXN-9104] ==
+
== Metabolite CPD-11407 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1,4-beta-d-xylan synthase
+
** thyroxine sulfate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.2.24 ec-2.4.2.24]
+
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[1-4-beta-Xylan]][c] '''+''' 1 [[UDP-D-XYLOSE]][c] '''=>''' 1 [[1-4-beta-Xylan]][c] '''+''' 1 [[UDP]][c]
+
** qyxijuzwssqict-lbprgkrzsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ22094]]
+
** 855.924
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-10614]]
−
* [[PWY-5800]], xylan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5800 PWY-5800]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
{{#set: common-name=thyroxine sulfate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=855.924}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15290 15290]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03928 R03928]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=1,4-beta-d-xylan synthase}}
 
−
{{#set: ec-number=ec-2.4.2.24}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-11407

  • common-name:
    • thyroxine sulfate
  • smiles:
    • c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
  • inchi-key:
    • qyxijuzwssqict-lbprgkrzsa-m
  • molecular-weight:
    • 855.924

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11407&oldid=139841"