Difference between revisions of "CPD-11407"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9104 RXN-9104] == * direction: ** left-to-right * common-name: ** 1,4-beta-d-xylan synthase * e...") |
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11407 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** thyroxine sulfate |
− | * | + | * smiles: |
− | ** | + | ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i) |
− | == | + | * inchi-key: |
− | + | ** qyxijuzwssqict-lbprgkrzsa-m | |
− | + | * molecular-weight: | |
− | * | + | ** 855.924 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-10614]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=thyroxine sulfate}} | |
− | + | {{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}} | |
− | * | + | {{#set: molecular-weight=855.924}} |
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-11407
- common-name:
- thyroxine sulfate
- smiles:
- c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
- inchi-key:
- qyxijuzwssqict-lbprgkrzsa-m
- molecular-weight:
- 855.924