Difference between revisions of "CPD-11407"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=D-PPENTOMUT-RXN D-PPENTOMUT-RXN] == * direction: ** reversible * common-name: ** d-deoxyribose 1,5-...")
 
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=D-PPENTOMUT-RXN D-PPENTOMUT-RXN] ==
+
== Metabolite CPD-11407 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** d-deoxyribose 1,5-phosphomutase
+
** thyroxine sulfate
−
** deoxyribose 1,5-phosphomutase
+
* smiles:
−
* ec-number:
+
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
−
** [http://enzyme.expasy.org/EC/5.4.2.7 ec-5.4.2.7]
+
* inchi-key:
−
== Reaction formula ==
+
** qyxijuzwssqict-lbprgkrzsa-m
−
* 1 [[DEOXY-D-RIBOSE-1-PHOSPHATE]][c] '''<=>''' 1 [[DEOXY-RIBOSE-5P]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 855.924
−
* Gene: [[SJ05004]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10614]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7180]], 2'-deoxy-&alpha;-D-ribose 1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7180 PWY-7180]
+
{{#set: common-name=thyroxine sulfate}}
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=855.924}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27661 27661]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02749 R02749]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q9CH12 Q9CH12]
 
−
** [http://www.uniprot.org/uniprot/O24821 O24821]
 
−
** [http://www.uniprot.org/uniprot/P0A6K6 P0A6K6]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=d-deoxyribose 1,5-phosphomutase|deoxyribose 1,5-phosphomutase}}
 
−
{{#set: ec-number=ec-5.4.2.7}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-11407

  • common-name:
    • thyroxine sulfate
  • smiles:
    • c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
  • inchi-key:
    • qyxijuzwssqict-lbprgkrzsa-m
  • molecular-weight:
    • 855.924

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11407&oldid=139841"