Difference between revisions of "CPD-11408"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1107 == * common-name: ** β-l-fucopyranose * smiles: ** cc1(oc(c(c(c1o)o)o)o) * inchi-key: ** shzgcjcmobcmkk-kgjvwpdlsa-n * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11408 == |
* common-name: | * common-name: | ||
| − | ** | + | ** triiodothyronine sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xbqyqxvjbndcgy-lbprgkrzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 730.028 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10615]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyronine sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=730.028}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11408
- common-name:
- triiodothyronine sulfate
- smiles:
- c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
- inchi-key:
- xbqyqxvjbndcgy-lbprgkrzsa-m
- molecular-weight:
- 730.028
