Difference between revisions of "CPD-11408"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.57-RXN 3.1.3.57-RXN] == * direction: ** left-to-right * common-name: ** inositol 1,4-bisphosp...")
 
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.57-RXN 3.1.3.57-RXN] ==
+
== Metabolite CPD-11408 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** inositol 1,4-bisphosphate 1-phosphatase
+
** triiodothyronine sulfate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.3.57 ec-3.1.3.57]
+
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
== Reaction formula ==
+
* inchi-key:
* 1 [[INOSITOL-1-4-BISPHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[D-MYO-INOSITOL-4-PHOSPHATE]][c] '''+''' 1 [[Pi]][c]
+
** xbqyqxvjbndcgy-lbprgkrzsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ05836]]
+
** 730.028
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-10615]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=triiodothyronine sulfate}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
* [[PWY-6363]], D-myo-inositol (1,4,5)-trisphosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6363 PWY-6363]
+
{{#set: molecular-weight=730.028}}
** '''3''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15554 15554]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03393 R03393]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P21327 P21327]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=inositol 1,4-bisphosphate 1-phosphatase}}
 
{{#set: ec-number=ec-3.1.3.57}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11408

  • common-name:
    • triiodothyronine sulfate
  • smiles:
    • c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
  • inchi-key:
    • xbqyqxvjbndcgy-lbprgkrzsa-m
  • molecular-weight:
    • 730.028

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality