Difference between revisions of "CPD-11408"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN == * common-name: ** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin * smiles: ** cc(=o)c(=o)[ch]1(cnc2(n=c(n)n...")
(Created page with "Category:metabolite == Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE == * common-name: ** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate * smiles: ** c(c(c(c([o-])=o)=o)o)op([o-])(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN ==
+
== Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE ==
 
* common-name:
 
* common-name:
** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin
+
** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
 
* smiles:
 
* smiles:
** cc(=o)c(=o)[ch]1(cnc2(n=c(n)nc(=o)c(n1)=2))
+
** c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** wbjzxbuveczhce-scsaibsysa-n
+
** mzjfvxdtnbhtkz-uwtatzphsa-k
 
* molecular-weight:
 
* molecular-weight:
** 237.218
+
** 211.045
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8853]]
+
* [[PSERTRANSAMPYR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.3.12-RXN]]
+
* [[PSERTRANSAMPYR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin}}
+
{{#set: common-name=(3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate}}
{{#set: inchi-key=inchikey=wbjzxbuveczhce-scsaibsysa-n}}
+
{{#set: inchi-key=inchikey=mzjfvxdtnbhtkz-uwtatzphsa-k}}
{{#set: molecular-weight=237.218}}
+
{{#set: molecular-weight=211.045}}

Revision as of 15:30, 5 January 2021

Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE

  • common-name:
    • (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
  • smiles:
    • c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
  • inchi-key:
    • mzjfvxdtnbhtkz-uwtatzphsa-k
  • molecular-weight:
    • 211.045

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality