Difference between revisions of "CPD-11409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...")
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-7-DIMETHYLXANTHINE ==
+
== Metabolite CPD-11409 ==
 
* common-name:
 
* common-name:
** theobromine
+
** tetraiodothyroacetate ether glucuronide
 
* smiles:
 
* smiles:
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
 
* inchi-key:
 
* inchi-key:
** yapqbxqyljrxsa-uhfffaoysa-n
+
** gyorpzqlvmnogy-rupwjetcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 180.166
+
** 921.943
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11519]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=theobromine}}
+
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}
{{#set: molecular-weight=180.166}}
+
{{#set: molecular-weight=921.943}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11409

  • common-name:
    • tetraiodothyroacetate ether glucuronide
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
  • inchi-key:
    • gyorpzqlvmnogy-rupwjetcsa-l
  • molecular-weight:
    • 921.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality