Difference between revisions of "CPD-11409"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine-527 == * common-name: ** a guanine527 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11578 == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11409 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate ether glucuronide |
| + | * smiles: | ||
| + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3)) | ||
| + | * inchi-key: | ||
| + | ** gyorpzqlvmnogy-rupwjetcsa-l | ||
| + | * molecular-weight: | ||
| + | ** 921.943 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10616]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate ether glucuronide}} |
| + | {{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}} | ||
| + | {{#set: molecular-weight=921.943}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11409
- common-name:
- tetraiodothyroacetate ether glucuronide
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
- inchi-key:
- gyorpzqlvmnogy-rupwjetcsa-l
- molecular-weight:
- 921.943
