Difference between revisions of "CPD-11409"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ZN+2 == * common-name: ** zn2+ * smiles: ** [zn++] * inchi-key: ** ptfcdoflopiggs-uhfffaoysa-n * molecular-weight: ** 65.38 == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11409 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate ether glucuronide |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gyorpzqlvmnogy-rupwjetcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 921.943 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10616]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate ether glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=921.943}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11409
- common-name:
- tetraiodothyroacetate ether glucuronide
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
- inchi-key:
- gyorpzqlvmnogy-rupwjetcsa-l
- molecular-weight:
- 921.943
