Difference between revisions of "CPD-11409"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-7836 == * common-name: ** myristate * smiles: ** cccccccccccccc([o-])=o * inchi-key: ** tunfsrhwotwdnc-uhfffaoysa-m * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7836 == |
* common-name: | * common-name: | ||
| − | ** | + | ** myristate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** tunfsrhwotwdnc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 227.366 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10727]] | ||
| + | * [[RXN-9626]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myristate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tunfsrhwotwdnc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=227.366}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-7836
- common-name:
- myristate
- smiles:
- cccccccccccccc([o-])=o
- inchi-key:
- tunfsrhwotwdnc-uhfffaoysa-m
- molecular-weight:
- 227.366
