Difference between revisions of "CPD-11411"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5131 RXN0-5131] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/2.7...") |
(Created page with "Category:metabolite == Metabolite CPD-11411 == * common-name: ** tetraiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11411 == |
| − | * | + | * common-name: |
| − | ** | + | ** tetraiodothyroacetate ester glucuronide |
| − | * | + | * smiles: |
| − | ** [ | + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3)) |
| − | == | + | * inchi-key: |
| − | + | ** xzmjvzbexskssm-kfyubchvsa-m | |
| − | = | + | * molecular-weight: |
| − | * | + | ** 922.95 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10617]] | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=tetraiodothyroacetate ester glucuronide}} | |
| − | == | + | {{#set: inchi-key=inchikey=xzmjvzbexskssm-kfyubchvsa-m}} |
| − | == | + | {{#set: molecular-weight=922.95}} |
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11411
- common-name:
- tetraiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
- inchi-key:
- xzmjvzbexskssm-kfyubchvsa-m
- molecular-weight:
- 922.95
