Difference between revisions of "CPD-11412"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20354 == * transcription-direction: ** positive * right-end-position: ** 184427 * left-end-position: ** 168482 * centisome-position: ** 80.684814...")
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20354 ==
+
== Metabolite CPD-11412 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** triiodothyroacetate ester glucuronide
−
* right-end-position:
+
* smiles:
−
** 184427
+
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
−
* left-end-position:
+
* inchi-key:
−
** 168482
+
** fpejnmnxcsitjo-kfyubchvsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 80.684814   
+
** 797.054
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10618]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.2.1.106-RXN]]
+
{{#set: common-name=triiodothyroacetate ester glucuronide}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=797.054}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[MALTODEXGLUCOSID-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14281]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14282]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14283]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15910]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5183]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7918]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7919]]
 
−
** '''1''' reactions found over '''20''' reactions in the full pathway
 
−
* [[PWY-842]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[GLYCOCAT-PWY]]
 
−
** '''6''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=184427}}
 
−
{{#set: left-end-position=168482}}
 
−
{{#set: centisome-position=80.684814    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11412

  • common-name:
    • triiodothyroacetate ester glucuronide
  • smiles:
    • c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
  • inchi-key:
    • fpejnmnxcsitjo-kfyubchvsa-m
  • molecular-weight:
    • 797.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11412&oldid=137258"