Difference between revisions of "CPD-11412"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22314 == * transcription-direction: ** negative * right-end-position: ** 155718 * left-end-position: ** 147066 * centisome-position: ** 82.57496...") |
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11412 == |
| − | * | + | * common-name: |
| − | ** | + | ** triiodothyroacetate ester glucuronide |
| − | * | + | * smiles: |
| − | ** | + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** fpejnmnxcsitjo-kfyubchvsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 797.054 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-10618]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=triiodothyroacetate ester glucuronide}} | |
| − | + | {{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}} | |
| − | + | {{#set: molecular-weight=797.054}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11412
- common-name:
- triiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
- inchi-key:
- fpejnmnxcsitjo-kfyubchvsa-m
- molecular-weight:
- 797.054
