Difference between revisions of "CPD-11412"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SER == * common-name: ** l-serine * smiles: ** c(o)c([n+])c(=o)[o-] * inchi-key: ** mtcfgrxmjlqnbg-reohclbhsa-n * molecular-weight: ** 10...")
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SER ==
+
== Metabolite CPD-11412 ==
 
* common-name:
 
* common-name:
** l-serine
+
** triiodothyroacetate ester glucuronide
 
* smiles:
 
* smiles:
** c(o)c([n+])c(=o)[o-]
+
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
 
* inchi-key:
 
* inchi-key:
** mtcfgrxmjlqnbg-reohclbhsa-n
+
** fpejnmnxcsitjo-kfyubchvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 105.093
+
** 797.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.3.1.17-RXN]]
 
* [[5.1.1.18-RXN]]
 
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-1382]]
 
* [[RXN-15125]]
 
* [[RXN0-2161]]
 
* [[RXN0-2382]]
 
* [[SERINE--TRNA-LIGASE-RXN]]
 
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
* [[SERINE-O-ACETTRAN-RXN]]
 
* [[TRYPSYN-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[RXN-10618]]
* [[GLYOHMETRANS-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-1382]]
 
* [[RXN-14136]]
 
* [[RXN0-5114]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-serine}}
+
{{#set: common-name=triiodothyroacetate ester glucuronide}}
{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
{{#set: molecular-weight=105.093}}
+
{{#set: molecular-weight=797.054}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11412

  • common-name:
    • triiodothyroacetate ester glucuronide
  • smiles:
    • c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
  • inchi-key:
    • fpejnmnxcsitjo-kfyubchvsa-m
  • molecular-weight:
    • 797.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality