Difference between revisions of "CPD-11412"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Histone-Acetyl-Lysine == * common-name: ** a [histone]-n6-acetyl-l-lysine == Reaction(s) known to consume the compound == * 3.5.1.98-RX...")
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Histone-Acetyl-Lysine ==
+
== Metabolite CPD-11412 ==
 
* common-name:
 
* common-name:
** a [histone]-n6-acetyl-l-lysine
+
** triiodothyroacetate ester glucuronide
 +
* smiles:
 +
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
 +
* inchi-key:
 +
** fpejnmnxcsitjo-kfyubchvsa-m
 +
* molecular-weight:
 +
** 797.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.98-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-10618]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [histone]-n6-acetyl-l-lysine}}
+
{{#set: common-name=triiodothyroacetate ester glucuronide}}
 +
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
 +
{{#set: molecular-weight=797.054}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11412

  • common-name:
    • triiodothyroacetate ester glucuronide
  • smiles:
    • c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
  • inchi-key:
    • fpejnmnxcsitjo-kfyubchvsa-m
  • molecular-weight:
    • 797.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality