Difference between revisions of "CPD-11412"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Carotenoid-psi-end-group == * common-name: ** a carotenoid ψ-end group == Reaction(s) known to consume the compound == * [[RXN-12496]...") |
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11412 == |
* common-name: | * common-name: | ||
| − | ** | + | ** triiodothyroacetate ester glucuronide |
| + | * smiles: | ||
| + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3)) | ||
| + | * inchi-key: | ||
| + | ** fpejnmnxcsitjo-kfyubchvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 797.054 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10618]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyroacetate ester glucuronide}} |
| + | {{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}} | ||
| + | {{#set: molecular-weight=797.054}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11412
- common-name:
- triiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
- inchi-key:
- fpejnmnxcsitjo-kfyubchvsa-m
- molecular-weight:
- 797.054
