Difference between revisions of "CPD-11412"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Histone-Acetyl-Lysine == * common-name: ** a [histone]-n6-acetyl-l-lysine == Reaction(s) known to consume the compound == * 3.5.1.98-RX...")
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) * inchi-key: ** suyjzkrqhbq...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Histone-Acetyl-Lysine ==
+
== Metabolite CPD-6992 ==
 
* common-name:
 
* common-name:
** a [histone]-n6-acetyl-l-lysine
+
** (+)-pinobanksin
 +
* smiles:
 +
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
 +
* inchi-key:
 +
** suyjzkrqhbqnca-lsdhhaiusa-m
 +
* molecular-weight:
 +
** 271.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.98-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-7648]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [histone]-n6-acetyl-l-lysine}}
+
{{#set: common-name=(+)-pinobanksin}}
 +
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
 +
{{#set: molecular-weight=271.249}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-6992

  • common-name:
    • (+)-pinobanksin
  • smiles:
    • c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
  • inchi-key:
    • suyjzkrqhbqnca-lsdhhaiusa-m
  • molecular-weight:
    • 271.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality