Difference between revisions of "CPD-11412"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) * inchi-key: ** suyjzkrqhbq...") |
(Created page with "Category:metabolite == Metabolite Carotenoid-psi-end-group == * common-name: ** a carotenoid ψ-end group == Reaction(s) known to consume the compound == * [[RXN-12496]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Carotenoid-psi-end-group == |
* common-name: | * common-name: | ||
| − | ** | + | ** a carotenoid ψ-end group |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12496]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a carotenoid ψ-end group}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite Carotenoid-psi-end-group
- common-name:
- a carotenoid ψ-end group
