Difference between revisions of "CPD-11495"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytidine-34-tRNAIle2 == * common-name: ** a cytidine34 in trnaile2 == Reaction(s) known to consume the compound == * RXN-1961 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11495 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2-hydroxyphenyl)acetate |
+ | * smiles: | ||
+ | ** c(=o)([o-])cc1(=c(o)c=cc=c1) | ||
+ | * inchi-key: | ||
+ | ** ccvyrrgzdbshfu-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 151.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10815]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2-hydroxyphenyl)acetate}} |
+ | {{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=151.141}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11495
- common-name:
- (2-hydroxyphenyl)acetate
- smiles:
- c(=o)([o-])cc1(=c(o)c=cc=c1)
- inchi-key:
- ccvyrrgzdbshfu-uhfffaoysa-m
- molecular-weight:
- 151.141