Difference between revisions of "CPD-11495"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)cccccccc=ccccccccc(=o)[o-] * inchi-key: ** lquhzvlttwmbto-uphrsur...") |
(Created page with "Category:metabolite == Metabolite CH3-MALONATE-S-ALD == * common-name: ** (s)-methylmalonate-semialdehyde * smiles: ** cc([ch]=o)c(=o)[o-] * inchi-key: ** vokumxabrrxhar-v...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CH3-MALONATE-S-ALD == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-methylmalonate-semialdehyde |
* smiles: | * smiles: | ||
− | ** | + | ** cc([ch]=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vokumxabrrxhar-vkhmyheasa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 101.082 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11213]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-methylmalonate-semialdehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vokumxabrrxhar-vkhmyheasa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=101.082}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CH3-MALONATE-S-ALD
- common-name:
- (s)-methylmalonate-semialdehyde
- smiles:
- cc([ch]=o)c(=o)[o-]
- inchi-key:
- vokumxabrrxhar-vkhmyheasa-m
- molecular-weight:
- 101.082