Difference between revisions of "CPD-11497"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-tyrosine-phosphates == * common-name: ** a [protein]-l-tyrosine phosphate == Reaction(s) known to consume the compound == * PRO...") |
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11497 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycol |
| + | * smiles: | ||
| + | ** coc1(=c(o)c=cc(c(o)co)=c1) | ||
| + | * inchi-key: | ||
| + | ** fbwpwwwzwkpjfl-qmmmgpobsa-n | ||
| + | * molecular-weight: | ||
| + | ** 184.191 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10915]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10915]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycol}} |
| + | {{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}} | ||
| + | {{#set: molecular-weight=184.191}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11497
- common-name:
- 3-methoxy-4-hydroxyphenylglycol
- smiles:
- coc1(=c(o)c=cc(c(o)co)=c1)
- inchi-key:
- fbwpwwwzwkpjfl-qmmmgpobsa-n
- molecular-weight:
- 184.191
