Difference between revisions of "CPD-11497"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04560 == * transcription-direction: ** positive * right-end-position: ** 47084 * left-end-position: ** 32977 * centisome-position: ** 31.225264...") |
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11497 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycol |
| − | * | + | * smiles: |
| − | ** | + | ** coc1(=c(o)c=cc(c(o)co)=c1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** fbwpwwwzwkpjfl-qmmmgpobsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 184.191 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10915]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN- | + | * [[RXN-10915]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycol}} | |
| − | + | {{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}} | |
| − | + | {{#set: molecular-weight=184.191}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11497
- common-name:
- 3-methoxy-4-hydroxyphenylglycol
- smiles:
- coc1(=c(o)c=cc(c(o)co)=c1)
- inchi-key:
- fbwpwwwzwkpjfl-qmmmgpobsa-n
- molecular-weight:
- 184.191
