Difference between revisions of "CPD-11512"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11410 == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([...")
(Created page with "Category:metabolite == Metabolite CPD-11512 == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11410 ==
+
== Metabolite CPD-11512 ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ether glucuronide
+
** a (2r,3s,4s)-leucoanthocyanidin
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
 
* inchi-key:
 
** vxvbzmwowmhxtq-kfyubchvsa-l
 
* molecular-weight:
 
** 796.046
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10619]]
+
* [[RXN-17678]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ether glucuronide}}
+
{{#set: common-name=a (2r,3s,4s)-leucoanthocyanidin}}
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
 
{{#set: molecular-weight=796.046}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-11512

  • common-name:
    • a (2r,3s,4s)-leucoanthocyanidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality