Difference between revisions of "CPD-11512"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17736 RXN-17736] == * direction: ** left-to-right * common-name: ** phosphatidylcholine 2-acylh...")
(Created page with "Category:metabolite == Metabolite CPD-11410 == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17736 RXN-17736] ==
+
== Metabolite CPD-11410 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphatidylcholine 2-acylhydrolase
+
** triiodothyroacetate ether glucuronide
−
** phospholipase a2
+
* smiles:
−
* ec-number:
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
−
** [http://enzyme.expasy.org/EC/3.1.1.4 ec-3.1.1.4]
+
* inchi-key:
−
== Reaction formula ==
+
** vxvbzmwowmhxtq-kfyubchvsa-l
−
* 1 [[PLASMENYLCHOLINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-563]][c] '''+''' 1 [[Fatty-Acids]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 796.046
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ09888]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-10619]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ16853]]
+
{{#set: common-name=triiodothyroacetate ether glucuronide}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=796.046}}
−
* Gene: [[SJ06461]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ12662]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ02841]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ18009]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ13501]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ04543]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-7783]], plasmalogen degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7783 PWY-7783]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phospholipase a2|phosphatidylcholine 2-acylhydrolase}}
 
−
{{#set: ec-number=ec-3.1.1.4}}
 
−
{{#set: nb gene associated=8}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-11410

  • common-name:
    • triiodothyroacetate ether glucuronide
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • vxvbzmwowmhxtq-kfyubchvsa-l
  • molecular-weight:
    • 796.046

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11512&oldid=47553"