Difference between revisions of "CPD-11512"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ALA-D-ALA ==
+
== Metabolite OXIDIZED-GLUTATHIONE ==
 
* common-name:
 
* common-name:
** d-alanyl-d-alanine
+
** glutathione disulfide
 
* smiles:
 
* smiles:
** cc([n+])c(=o)nc(c)c([o-])=o
+
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** defjqiddeaulhb-qwwzwvqmsa-n
+
** ypzrwbkmtbyptk-bjdjzhngsa-l
 
* molecular-weight:
 
* molecular-weight:
** 160.172
+
** 610.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GDR]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DALADALALIG-RXN]]
+
* [[1.11.1.12-RXN]]
 +
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-alanyl-d-alanine}}
+
{{#set: common-name=glutathione disulfide}}
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
+
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
{{#set: molecular-weight=160.172}}
+
{{#set: molecular-weight=610.61}}

Revision as of 13:11, 14 January 2021

Metabolite OXIDIZED-GLUTATHIONE

  • common-name:
    • glutathione disulfide
  • smiles:
    • c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ypzrwbkmtbyptk-bjdjzhngsa-l
  • molecular-weight:
    • 610.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality