Difference between revisions of "CPD-11512"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
(Created page with "Category:metabolite == Metabolite Protein-L-Arginines == * common-name: ** a [protein]-l-arginine == Reaction(s) known to consume the compound == * 2.4.2.31-RXN * PR...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXIDIZED-GLUTATHIONE ==
+
== Metabolite Protein-L-Arginines ==
 
* common-name:
 
* common-name:
** glutathione disulfide
+
** a [protein]-l-arginine
* smiles:
 
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** ypzrwbkmtbyptk-bjdjzhngsa-l
 
* molecular-weight:
 
** 610.61
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GDR]]
+
* [[2.4.2.31-RXN]]
* [[GDR_LPAREN_nadp_RPAREN_]]
+
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
* [[GDR_LPAREN_nadp_RPAREN_h]]
+
* [[RXN-16889]]
* [[GDR_LPAREN_nadp_RPAREN_m]]
+
* [[RXN-17120]]
* [[GDRh]]
+
* [[RXN-17121]]
* [[GDRm]]
+
* [[RXN8J2-139]]
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.12-RXN]]
+
* [[2.4.2.31-RXN]]
* [[1.8.4.9-RXN]]
+
* [[RXN-17120]]
* [[1.8.5.1-RXN]]
+
* [[RXN-17121]]
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[RXN8J2-139]]
* [[GTHP]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutathione disulfide}}
+
{{#set: common-name=a [protein]-l-arginine}}
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
 
{{#set: molecular-weight=610.61}}
 

Revision as of 18:57, 14 January 2021

Metabolite Protein-L-Arginines

  • common-name:
    • a [protein]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.