Difference between revisions of "CPD-11517"

Revision as of 11:16, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11517 ==
+== Metabolite Nonmethylated-Ribosomal-Protein-L11s ==
 * common-name:
-** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa
+** a non-methylated ribosomal protein l11
-* smiles:
-** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
-* inchi-key:
-** jziqdjlbfktbak-llhoyasasa-j
-* molecular-weight:
-** 1039.92
 == Reaction(s) known to consume the compound ==
-* [[RXN-10696]]
+* [[RXN0-5419]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa}}
+{{#set: common-name=a non-methylated ribosomal protein l11}}
-{{#set: inchi-key=inchikey=jziqdjlbfktbak-llhoyasasa-j}}
-{{#set: molecular-weight=1039.92}}