Difference between revisions of "CPD-11517"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOACYL-COA == * common-name: ** a 3-oxoacyl-coa == Reaction(s) known to consume the compound == * KETOACYLCOATHIOL-RXN * RXN-13...")
(Created page with "Category:metabolite == Metabolite CPD-11517 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)c...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETOACYL-COA ==
+
== Metabolite CPD-11517 ==
 
* common-name:
 
* common-name:
** a 3-oxoacyl-coa
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa
 +
* smiles:
 +
** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 +
* inchi-key:
 +
** jziqdjlbfktbak-llhoyasasa-j
 +
* molecular-weight:
 +
** 1039.92
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOACYLCOATHIOL-RXN]]
+
* [[RXN-10696]]
* [[RXN-13279]]
 
* [[RXN-16133]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHACYL-COA-DEHYDROG-RXN]]
 
* [[RXN-13279]]
 
* [[RXN-16133]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxoacyl-coa}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa}}
 +
{{#set: inchi-key=inchikey=jziqdjlbfktbak-llhoyasasa-j}}
 +
{{#set: molecular-weight=1039.92}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-11517

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • jziqdjlbfktbak-llhoyasasa-j
  • molecular-weight:
    • 1039.92

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality