Difference between revisions of "CPD-11518"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...")
(Created page with "Category:metabolite == Metabolite CPD-11518 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc=cc(s...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7025 ==
+
== Metabolite CPD-11518 ==
 
* common-name:
 
* common-name:
** phytyl monophosphate
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa
 
* smiles:
 
* smiles:
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
+
** ccc=ccc1(c(ccc(=o)1)cccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
* inchi-key:
** yrxrhzokdfcxib-pyddkjgssa-l
+
** wdbpmrzybzciqe-dzxubonnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 374.499
+
** 1037.905
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10697]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7683]]
+
* [[RXN-10696]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytyl monophosphate}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa}}
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
+
{{#set: inchi-key=inchikey=wdbpmrzybzciqe-dzxubonnsa-j}}
{{#set: molecular-weight=374.499}}
+
{{#set: molecular-weight=1037.905}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-11518

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • wdbpmrzybzciqe-dzxubonnsa-j
  • molecular-weight:
    • 1037.905

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality