Difference between revisions of "CPD-11518"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...")
(Created page with "Category:metabolite == Metabolite 5-Phospho-terminated-DNAs == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * [[DNA-LIGASE-ATP-RXN]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11523 ==
+
== Metabolite 5-Phospho-terminated-DNAs ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
+
** a 5'-phospho-[dna]
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** omdqviuydjawhx-qhzcmhftsa-j
 
* molecular-weight:
 
** 1027.866
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10702]]
+
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DNA-LIGASE-NAD+-RXN]]
 +
* [[RXN-15712]]
 +
* [[RXN-15713]]
 +
* [[RXN-17918]]
 +
* [[RXN-17922]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10704]]
+
* [[4.2.99.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
+
{{#set: common-name=a 5'-phospho-[dna]}}
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
 
{{#set: molecular-weight=1027.866}}
 

Revision as of 15:27, 5 January 2021

Metabolite 5-Phospho-terminated-DNAs

  • common-name:
    • a 5'-phospho-[dna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-phospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.