Difference between revisions of "CPD-11519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09653 == * transcription-direction: ** positive * right-end-position: ** 29154 * left-end-position: ** 18956 * centisome-position: ** 49.86846...")
(Created page with "Category:metabolite == Metabolite CPD-11519 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09653 ==
+
== Metabolite CPD-11519 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa
* right-end-position:
+
* smiles:
** 29154
+
** ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
* left-end-position:
+
* inchi-key:
** 18956
+
** pddhcvxpabqiso-xjjfhseksa-j
* centisome-position:
+
* molecular-weight:
** 49.86846   
+
** 1055.92
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10698]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PEROXID-RXN]]
+
* [[RXN-10697]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa}}
* [[RXN-14240]]
+
{{#set: inchi-key=inchikey=pddhcvxpabqiso-xjjfhseksa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=1055.92}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-15288]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17352]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-8635]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7214]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-7445]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-5466]]
 
** '''2''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-6824]]
 
** '''2''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-5469]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-5461]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=29154}}
 
{{#set: left-end-position=18956}}
 
{{#set: centisome-position=49.86846    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11519

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • pddhcvxpabqiso-xjjfhseksa-j
  • molecular-weight:
    • 1055.92

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality