Difference between revisions of "CPD-11520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12953 == * transcription-direction: ** positive * right-end-position: ** 25369 * left-end-position: ** 13172 * centisome-position: ** 3.7793882...")
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12953 ==
+
== Metabolite CPD-11520 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
−
* right-end-position:
+
* smiles:
−
** 25369
+
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 13172
+
** yyccmactoajggw-ozvhgmpnsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 3.7793882   
+
** 1053.904
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10699]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLUTAMIDOTRANS-RXN]]
+
* [[RXN-10698]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
−
* [[GLUTAMIN-RXN]]
+
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=1053.904}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PRIBFAICARPISOM-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PRICI]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17900]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[HISTSYN-PWY]]
 
−
** '''10''' reactions found over '''10''' reactions in the full pathway
 
−
* [[CITRULBIO-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[GLUTAMINDEG-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=25369}}
 
−
{{#set: left-end-position=13172}}
 
−
{{#set: centisome-position=3.7793882    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11520

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • yyccmactoajggw-ozvhgmpnsa-j
  • molecular-weight:
    • 1053.904

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11520&oldid=137498"