Difference between revisions of "CPD-11522"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11376 RXN-11376] == * direction: ** left-to-right * common-name: ** sphingoid base kinase * ec-...")
(Created page with "Category:metabolite == Metabolite CPD-11522 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc=cc(scc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11376 RXN-11376] ==
+
== Metabolite CPD-11522 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** sphingoid base kinase
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.91 ec-2.7.1.91]
+
** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[Sphingoids]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Sphingoid-1-phosphates]][c]
+
** ieeneqseowxdqk-dioafzbusa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16261]]
+
** 1009.851
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10704]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6483]], ceramide degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6483 PWY-6483]
+
* [[RXN-10706]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}}
−
== External links  ==
+
{{#set: molecular-weight=1009.851}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=51497 51497]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=sphingoid base kinase}}
 
−
{{#set: ec-number=ec-2.7.1.91}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11522

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • ieeneqseowxdqk-dioafzbusa-j
  • molecular-weight:
    • 1009.851

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11522&oldid=139609"