Difference between revisions of "CPD-11522"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4186 == * common-name: ** lathosterol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)cc(o)cc3)))cc4)))c * inchi-...")
(Created page with "Category:metabolite == Metabolite CPD-11522 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc=cc(scc...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4186 ==
+
== Metabolite CPD-11522 ==
 
* common-name:
 
* common-name:
** lathosterol
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)cc(o)cc3)))cc4)))c
+
** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
* inchi-key:
** izvffxvybhfihy-skcnuyalsa-n
+
** ieeneqseowxdqk-dioafzbusa-j
 
* molecular-weight:
 
* molecular-weight:
** 386.66
+
** 1009.851
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.21.6-RXN]]
+
* [[RXN-10704]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-321]]
+
* [[RXN-10706]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lathosterol}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}}
{{#set: inchi-key=inchikey=izvffxvybhfihy-skcnuyalsa-n}}
+
{{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}}
{{#set: molecular-weight=386.66}}
+
{{#set: molecular-weight=1009.851}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11522

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • ieeneqseowxdqk-dioafzbusa-j
  • molecular-weight:
    • 1009.851

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality