Difference between revisions of "CPD-11522"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9912 RXN-9912] == * direction: ** left-to-right * common-name: ** 4-chlorosalicylate monooxygen...")
 
(Created page with "Category:metabolite == Metabolite CPD-11522 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc=cc(scc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9912 RXN-9912] ==
+
== Metabolite CPD-11522 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 4-chlorosalicylate monooxygenase
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
** salicylate 1-monooxygenase
+
* smiles:
* ec-number:
+
** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
** [http://enzyme.expasy.org/EC/1.14.13.1 ec-1.14.13.1]
+
* inchi-key:
* synonymous:
+
** ieeneqseowxdqk-dioafzbusa-j
** 4-chlorosalicylate hydroxylase
+
* molecular-weight:
== Reaction formula ==
+
** 1009.851
* 1 [[CPD-10576]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-9152]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to consume the compound ==
== Gene(s) associated with this reaction  ==
+
* [[RXN-10704]]
* Gene: [[SJ21101]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-10706]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}}
* [[PWY-6107]], chlorosalicylate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6107 PWY-6107]
+
{{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}}
** '''2''' reactions found over '''7''' reactions in the full pathway
+
{{#set: molecular-weight=1009.851}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=4-chlorosalicylate monooxygenase|salicylate 1-monooxygenase}}
 
{{#set: ec-number=ec-1.14.13.1}}
 
{{#set: synonymous=4-chlorosalicylate hydroxylase}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11522

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • ieeneqseowxdqk-dioafzbusa-j
  • molecular-weight:
    • 1009.851

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality