Difference between revisions of "CPD-11522"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9912 RXN-9912] == * direction: ** left-to-right * common-name: ** 4-chlorosalicylate monooxygen...") |
(Created page with "Category:metabolite == Metabolite CPD-11522 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc=cc(scc...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11522 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa |
− | + | * smiles: | |
− | + | ** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) | |
− | + | * inchi-key: | |
− | * | + | ** ieeneqseowxdqk-dioafzbusa-j |
− | ** | + | * molecular-weight: |
− | == | + | ** 1009.851 |
− | + | == Reaction(s) known to consume the compound == | |
− | == | + | * [[RXN-10704]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-10706]] |
− | *** | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}} |
− | * [[ | + | {{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}} |
− | + | {{#set: molecular-weight=1009.851}} | |
− | == | ||
− | * | ||
− | == | ||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11522
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
- inchi-key:
- ieeneqseowxdqk-dioafzbusa-j
- molecular-weight:
- 1009.851