Difference between revisions of "CPD-11522"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite Protein-L-methionine == * common-name: ** a [protein]-l-methionine == Reaction(s) known to consume the compound == * 1.8.4.12-RXN ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-methionine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-methionine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.8.4.12-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1.8.4.12-RXN]] |
| + | * [[RXN-8668]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-methionine}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite Protein-L-methionine
- common-name:
- a [protein]-l-methionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
