|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ04060 == | + | == Metabolite CPD-11523 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 354412
| + | ** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 335957
| + | ** omdqviuydjawhx-qhzcmhftsa-j |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 64.82553 | + | ** 1027.866 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-10702]] |
| − | == Reaction(s) associated ==
| + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN-10704]] |
| − | * [[RXN-12587]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=1027.866}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-12588]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14382]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN-14384]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14385]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14386]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-15881]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-9787]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN0-308]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6892]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7250]]
| |
| − | ** '''5''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6891]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY0-1021]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-6823]]
| |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7904]]
| |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7892]]
| |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7891]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7889]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7888]]
| |
| − | ** '''2''' reactions found over '''7''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}}
| |
| − | {{#set: right-end-position=354412}} | |
| − | {{#set: left-end-position=335957}}
| |
| − | {{#set: centisome-position=64.82553 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=9}}
| |
| − | {{#set: nb pathway associated=10}}
| |
