Difference between revisions of "CPD-11524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * smiles: ** cc(c)c(o)(cc(=o)[o-])c([o-])=o * inchi-key: ** b...")
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE ==
+
== Metabolite CPD-11524 ==
 
* common-name:
 
* common-name:
** (2s)-2-isopropylmalate
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
 
* smiles:
 
* smiles:
** cc(c)c(o)(cc(=o)[o-])c([o-])=o
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
* inchi-key:
** bityxlxucsktjs-zetcqymhsa-l
+
** adgirvmshggghu-azvxsvfwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 174.153
+
** 1025.85
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-ISOPROPYLMALISOM-RXN]]
+
* [[RXN-10700]]
* [[RXN-13163]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ISOPROPYLMALATESYN-RXN]]
+
* [[RXN-10702]]
* [[3-ISOPROPYLMALISOM-RXN]]
 
* [[IPMS]]
 
* [[RXN-13163]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-2-isopropylmalate}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
+
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
{{#set: molecular-weight=174.153}}
+
{{#set: molecular-weight=1025.85}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11524

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • adgirvmshggghu-azvxsvfwsa-j
  • molecular-weight:
    • 1025.85

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality