Difference between revisions of "CPD-11524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03668 == * transcription-direction: ** negative * right-end-position: ** 491696 * left-end-position: ** 477233 * centisome-position: ** 91.47003...")
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03668 ==
+
== Metabolite CPD-11524 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
−
* right-end-position:
+
* smiles:
−
** 491696
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 477233
+
** adgirvmshggghu-azvxsvfwsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 91.47003   
+
** 1025.85
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10700]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLYOHMETRANS-RXN]]
+
* [[RXN-10702]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1025.85}}
−
* [[RXN0-5234]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[1CMET2-PWY]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5497]]
 
−
** '''10''' reactions found over '''24''' reactions in the full pathway
 
−
* [[PWY-181]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-3661]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-2201]]
 
−
** '''9''' reactions found over '''12''' reactions in the full pathway
 
−
* [[GLYSYN-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-3661-1]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-1622]]
 
−
** '''6''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-3841]]
 
−
** '''9''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-2161]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=491696}}
 
−
{{#set: left-end-position=477233}}
 
−
{{#set: centisome-position=91.47003    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=10}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11524

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • adgirvmshggghu-azvxsvfwsa-j
  • molecular-weight:
    • 1025.85

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11524&oldid=137224"