Difference between revisions of "CPD-11524"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7275 == * common-name: ** (24r,25r)-3α,7α,12α,24-tetrahydroxy-5β-cholestanoyl coa * smiles: ** cc(ccc(o)c(c)c(...") |
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11524 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** adgirvmshggghu-azvxsvfwsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1025.85 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10700]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10702]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1025.85}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11524
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
- inchi-key:
- adgirvmshggghu-azvxsvfwsa-j
- molecular-weight:
- 1025.85