Difference between revisions of "CPD-11524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17646 == * transcription-direction: ** positive * right-end-position: ** 1045935 * left-end-position: ** 1029685 * centisome-position: ** 89.50778...")
(Created page with "Category:metabolite == Metabolite DIHYDROXY-ACETONE-PHOSPHATE == * common-name: ** glycerone phosphate * smiles: ** c(c(=o)co)op([o-])([o-])=o * inchi-key: ** gngacratggdk...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17646 ==
+
== Metabolite DIHYDROXY-ACETONE-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** glycerone phosphate
−
* right-end-position:
+
* smiles:
−
** 1045935
+
** c(c(=o)co)op([o-])([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 1029685
+
** gngacratggdkbx-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 89.50778   
+
** 168.043
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.1.1.8-RXN]]
−
== Reaction(s) associated ==
+
* [[2.3.1.42-RXN]]
−
* [[PEROXID-RXN]]
+
* [[F16ALDOLASE-RXN]]
−
** Category: [[annotation]]
+
* [[FBA_]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[G3PD2]]
−
* [[RXN-14240]]
+
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
−
** Category: [[annotation]]
+
* [[QUINOLINATE-SYNTHA-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
−
* [[RXN-15288]]
+
* [[RXN-15044]]
−
** Category: [[annotation]]
+
* [[SEDOBISALDOL-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TRIOSEPISOMERIZATION-RXN]]
−
* [[RXN-17352]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[F16ALDOLASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[FBA_]]
−
* [[RXN-8635]]
+
* [[G3PD2]]
−
** Category: [[annotation]]
+
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLYCERONE-KINASE-RXN]]
−
== Pathway(s) associated ==
+
* [[RXN-15740]]
−
* [[PWY-7214]]
+
* [[RXN-15745]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-8631]]
−
* [[PWY-7445]]
+
* [[RXN0-5260]]
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[SEDOBISALDOL-RXN]]
−
* [[PWY-5466]]
+
* [[TAGAALDOL-RXN]]
−
** '''2''' reactions found over '''10''' reactions in the full pathway
+
* [[TRIOSEPISOMERIZATION-RXN]]
−
* [[PWY-6824]]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''10''' reactions in the full pathway
+
{{#set: common-name=glycerone phosphate}}
−
* [[PWY-5469]]
+
{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=168.043}}
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=1045935}}
 
−
{{#set: left-end-position=1029685}}
 
−
{{#set: centisome-position=89.50778    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:31, 18 December 2020

Metabolite DIHYDROXY-ACETONE-PHOSPHATE

  • common-name:
    • glycerone phosphate
  • smiles:
    • c(c(=o)co)op([o-])([o-])=o
  • inchi-key:
    • gngacratggdkbx-uhfffaoysa-l
  • molecular-weight:
    • 168.043

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11524&oldid=46040"