Difference between revisions of "CPD-11525"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ETHYLMALEIMIDE == * common-name: ** n-ethylmaleimide * smiles: ** ccn1(c(=o)c=cc(=o)1) * inchi-key: ** hdfgopsgaurceo-uhfffaoysa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11525 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yyuzysvpfvoylb-rguwmiccsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 983.813 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10707]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10700]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=983.813}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11525
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
- inchi-key:
- yyuzysvpfvoylb-rguwmiccsa-j
- molecular-weight:
- 983.813