Difference between revisions of "CPD-11525"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20712 == * transcription-direction: ** negative * right-end-position: ** 86062 * left-end-position: ** 67008 * centisome-position: ** 32.776527...")
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20712 ==
+
== Metabolite CPD-11525 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 86062
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
−
* left-end-position:
+
* inchi-key:
−
** 67008
+
** yyuzysvpfvoylb-rguwmiccsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 32.776527   
+
** 983.813
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10707]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GPPSYN-RXN]]
+
* [[RXN-10700]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
−
* [[RXN-8999]]
+
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=983.813}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-6383]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7410]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7102]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6859]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7736]]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5122]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-7141]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7659]]
 
−
** '''1''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7709]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5123]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7182]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5785]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=86062}}
 
−
{{#set: left-end-position=67008}}
 
−
{{#set: centisome-position=32.776527    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=12}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-11525

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
  • inchi-key:
    • yyuzysvpfvoylb-rguwmiccsa-j
  • molecular-weight:
    • 983.813

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11525&oldid=137861"