Difference between revisions of "CPD-11528"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite mRNAs-With-PolyA-Tails == * common-name: ** a mrna with poly(a) tail == Reaction(s) known to consume the compound == * 3.1.13.4-RXN =...")
(Created page with "Category:metabolite == Metabolite CPD-11528 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite mRNAs-With-PolyA-Tails ==
+
== Metabolite CPD-11528 ==
 
* common-name:
 
* common-name:
** a mrna with poly(a) tail
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa
 +
* smiles:
 +
** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 +
* inchi-key:
 +
** qgjlcxxjefrwhp-jqukjzmasa-j
 +
* molecular-weight:
 +
** 997.797
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.13.4-RXN]]
+
* [[RXN-10701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10703]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a mrna with poly(a) tail}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa}}
 +
{{#set: inchi-key=inchikey=qgjlcxxjefrwhp-jqukjzmasa-j}}
 +
{{#set: molecular-weight=997.797}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11528

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
  • inchi-key:
    • qgjlcxxjefrwhp-jqukjzmasa-j
  • molecular-weight:
    • 997.797

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality